About cyclopropane;ethane;2-ethyl-5-methylfuran
cyclopropane;ethane;2-ethyl-5-methylfuran (PubChem CID 142234007) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is cyclopropane;ethane;2-ethyl-5-methylfuran.
Molecular Properties
| Compound Name | cyclopropane;ethane;2-ethyl-5-methylfuran |
| PubChem CID | 142234007 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | cyclopropane;ethane;2-ethyl-5-methylfuran |
| SMILES | C1CC1.CC.CC.CCc1ccc(C)o1 |
| InChI | InChI=1S/C7H10O.C3H6.2C2H6/c1-3-7-5-4-6(2)8-7;1-2-3-1;2*1-2/h4-5H,3H2,1-2H3;1-3H2;2*1-2H3 |
| InChIKey | ZMUKNOMVMJBXFW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopropane;ethane;2-ethyl-5-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;ethane;2-ethyl-5-methylfuran?
The IUPAC name of cyclopropane;ethane;2-ethyl-5-methylfuran (CID 142234007) is cyclopropane;ethane;2-ethyl-5-methylfuran.
What is the SMILES notation for cyclopropane;ethane;2-ethyl-5-methylfuran?
The canonical SMILES for cyclopropane;ethane;2-ethyl-5-methylfuran is C1CC1.CC.CC.CCc1ccc(C)o1.
What is the InChIKey of cyclopropane;ethane;2-ethyl-5-methylfuran?
The InChIKey is ZMUKNOMVMJBXFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C3H6.2C2H6/c1-3-7-5-4-6(2)8-7;1-2-3-1;2*1-2/h4-5H,3H2,1-2H3;1-3H2;2*1-2H3.
What are the key properties of cyclopropane;ethane;2-ethyl-5-methylfuran?
cyclopropane;ethane;2-ethyl-5-methylfuran has a molecular weight of 212.38 g/mol, XLogP of 5.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;ethane;2-ethyl-5-methylfuran is sourced from PubChem (CID 142234007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).