C14H18O2 — CID 175370642
furan-2-ylmethanol;1,2,3-trimethylbenzene (PubChem CID 175370642) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is furan-2-ylmethanol;1,2,3-trimethylbenzene.
| Compound Name | furan-2-ylmethanol;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 175370642 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | furan-2-ylmethanol;1,2,3-trimethylbenzene |
| SMILES | Cc1cccc(C)c1C.OCc1ccco1 |
| InChI | InChI=1S/C9H12.C5H6O2/c1-7-5-4-6-8(2)9(7)3;6-4-5-2-1-3-7-5/h4-6H,1-3H3;1-3,6H,4H2 |
| InChIKey | LEWPJPAHQRMDEX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |