About ethane;(4-methylphenyl)methanol;hydrate
ethane;(4-methylphenyl)methanol;hydrate (PubChem CID 144684706) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is ethane;(4-methylphenyl)methanol;hydrate.
Molecular Properties
| Compound Name | ethane;(4-methylphenyl)methanol;hydrate |
| PubChem CID | 144684706 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | ethane;(4-methylphenyl)methanol;hydrate |
| SMILES | CC.Cc1ccc(CO)cc1.O |
| InChI | InChI=1S/C8H10O.C2H6.H2O/c1-7-2-4-8(6-9)5-3-7;1-2;/h2-5,9H,6H2,1H3;1-2H3;1H2 |
| InChIKey | KURNMAUUXNIUQJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(4-methylphenyl)methanol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4-methylphenyl)methanol;hydrate?
The IUPAC name of ethane;(4-methylphenyl)methanol;hydrate (CID 144684706) is ethane;(4-methylphenyl)methanol;hydrate.
What is the SMILES notation for ethane;(4-methylphenyl)methanol;hydrate?
The canonical SMILES for ethane;(4-methylphenyl)methanol;hydrate is CC.Cc1ccc(CO)cc1.O.
What is the InChIKey of ethane;(4-methylphenyl)methanol;hydrate?
The InChIKey is KURNMAUUXNIUQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C2H6.H2O/c1-7-2-4-8(6-9)5-3-7;1-2;/h2-5,9H,6H2,1H3;1-2H3;1H2.
What are the key properties of ethane;(4-methylphenyl)methanol;hydrate?
ethane;(4-methylphenyl)methanol;hydrate has a molecular weight of 170.25 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-methylphenyl)methanol;hydrate is sourced from PubChem (CID 144684706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).