C11H10Cl6O2 — CID 91571540
1,1,1,3,3,3-hexachloropropan-2-one;(4-methylphenyl)methanol (PubChem CID 91571540) has the molecular formula C11H10Cl6O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexachloropropan-2-one;(4-methylphenyl)methanol.
| Compound Name | 1,1,1,3,3,3-hexachloropropan-2-one;(4-methylphenyl)methanol |
|---|---|
| PubChem CID | 91571540 |
| Molecular Formula | C11H10Cl6O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | 1,1,1,3,3,3-hexachloropropan-2-one;(4-methylphenyl)methanol |
| SMILES | Cc1ccc(CO)cc1.O=C(C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10O.C3Cl6O/c1-7-2-4-8(6-9)5-3-7;4-2(5,6)1(10)3(7,8)9/h2-5,9H,6H2,1H3; |
| InChIKey | OJZCFTJNZTXFIO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|