C10H9ClF2O — CID 105473373
2,2-difluoro-3-(4-methylphenyl)propanoyl chloride (PubChem CID 105473373) has the molecular formula C10H9ClF2O and a molecular weight of 218.63 g/mol. Its IUPAC name is 2,2-difluoro-3-(4-methylphenyl)propanoyl chloride.
| Compound Name | 2,2-difluoro-3-(4-methylphenyl)propanoyl chloride |
|---|---|
| PubChem CID | 105473373 |
| Molecular Formula | C10H9ClF2O |
| Molecular Weight | 218.63 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2,2-difluoro-3-(4-methylphenyl)propanoyl chloride |
| SMILES | Cc1ccc(CC(F)(F)C(=O)Cl)cc1 |
| InChI | InChI=1S/C10H9ClF2O/c1-7-2-4-8(5-3-7)6-10(12,13)9(11)14/h2-5H,6H2,1H3 |
| InChIKey | HRWBEOJAUARDPD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|