C11H11F4NO — CID 103731962
2,2,3,3-tetrafluoro-N-[(4-methylphenyl)methyl]propanamide (PubChem CID 103731962) has the molecular formula C11H11F4NO and a molecular weight of 249.21 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(4-methylphenyl)methyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(4-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 103731962 |
| Molecular Formula | C11H11F4NO |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(4-methylphenyl)methyl]propanamide |
| SMILES | Cc1ccc(CNC(=O)C(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H11F4NO/c1-7-2-4-8(5-3-7)6-16-10(17)11(14,15)9(12)13/h2-5,9H,6H2,1H3,(H,16,17) |
| InChIKey | UKTGLFAVNUBKPI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|