C19H22Cl2 — CID 134888789
1-[2,2-bis(chloromethyl)-3-(4-methylphenyl)propyl]-4-methylbenzene (PubChem CID 134888789) has the molecular formula C19H22Cl2 and a molecular weight of 321.29 g/mol. Its IUPAC name is 1-[2,2-bis(chloromethyl)-3-(4-methylphenyl)propyl]-4-methylbenzene.
| Compound Name | 1-[2,2-bis(chloromethyl)-3-(4-methylphenyl)propyl]-4-methylbenzene |
|---|---|
| PubChem CID | 134888789 |
| Molecular Formula | C19H22Cl2 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-[2,2-bis(chloromethyl)-3-(4-methylphenyl)propyl]-4-methylbenzene |
| SMILES | Cc1ccc(CC(CCl)(CCl)Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H22Cl2/c1-15-3-7-17(8-4-15)11-19(13-20,14-21)12-18-9-5-16(2)6-10-18/h3-10H,11-14H2,1-2H3 |
| InChIKey | QCUQSVUKJMDHBW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|