C14H19Cl2I — CID 79447299
1-[2,2-bis(chloromethyl)-4-methylpentyl]-4-iodobenzene (PubChem CID 79447299) has the molecular formula C14H19Cl2I and a molecular weight of 385.12 g/mol. Its IUPAC name is 1-[2,2-bis(chloromethyl)-4-methylpentyl]-4-iodobenzene.
| Compound Name | 1-[2,2-bis(chloromethyl)-4-methylpentyl]-4-iodobenzene |
|---|---|
| PubChem CID | 79447299 |
| Molecular Formula | C14H19Cl2I |
| Molecular Weight | 385.12 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 1-[2,2-bis(chloromethyl)-4-methylpentyl]-4-iodobenzene |
| SMILES | CC(C)CC(CCl)(CCl)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C14H19Cl2I/c1-11(2)7-14(9-15,10-16)8-12-3-5-13(17)6-4-12/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | LWQUEOYRWCHEBM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.12 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|