C15H26Cl2N2 — CID 79448133
3-[2,2-bis(chloromethyl)-4-methylpentyl]-1-butan-2-ylpyrazole (PubChem CID 79448133) has the molecular formula C15H26Cl2N2 and a molecular weight of 305.29 g/mol. Its IUPAC name is 3-[2,2-bis(chloromethyl)-4-methylpentyl]-1-butan-2-ylpyrazole.
| Compound Name | 3-[2,2-bis(chloromethyl)-4-methylpentyl]-1-butan-2-ylpyrazole |
|---|---|
| PubChem CID | 79448133 |
| Molecular Formula | C15H26Cl2N2 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-[2,2-bis(chloromethyl)-4-methylpentyl]-1-butan-2-ylpyrazole |
| SMILES | CCC(C)n1ccc(CC(CCl)(CCl)CC(C)C)n1 |
| InChI | InChI=1S/C15H26Cl2N2/c1-5-13(4)19-7-6-14(18-19)9-15(10-16,11-17)8-12(2)3/h6-7,12-13H,5,8-11H2,1-4H3 |
| InChIKey | RPINEFHSFGJLDX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|