C14H27N3 — CID 64778198
5-(1-butan-2-ylpyrazol-3-yl)-4,4-dimethylpentan-2-amine (PubChem CID 64778198) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 5-(1-butan-2-ylpyrazol-3-yl)-4,4-dimethylpentan-2-amine.
| Compound Name | 5-(1-butan-2-ylpyrazol-3-yl)-4,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 64778198 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 5-(1-butan-2-ylpyrazol-3-yl)-4,4-dimethylpentan-2-amine |
| SMILES | CCC(C)n1ccc(CC(C)(C)CC(C)N)n1 |
| InChI | InChI=1S/C14H27N3/c1-6-12(3)17-8-7-13(16-17)10-14(4,5)9-11(2)15/h7-8,11-12H,6,9-10,15H2,1-5H3 |
| InChIKey | AWUVRVIERILCMX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |