C15H27BrN2 — CID 64778970
3-(4-bromo-2,2-dimethylpentyl)-1-pentan-3-ylpyrazole (PubChem CID 64778970) has the molecular formula C15H27BrN2 and a molecular weight of 315.30 g/mol. Its IUPAC name is 3-(4-bromo-2,2-dimethylpentyl)-1-pentan-3-ylpyrazole.
| Compound Name | 3-(4-bromo-2,2-dimethylpentyl)-1-pentan-3-ylpyrazole |
|---|---|
| PubChem CID | 64778970 |
| Molecular Formula | C15H27BrN2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-(4-bromo-2,2-dimethylpentyl)-1-pentan-3-ylpyrazole |
| SMILES | CCC(CC)n1ccc(CC(C)(C)CC(C)Br)n1 |
| InChI | InChI=1S/C15H27BrN2/c1-6-14(7-2)18-9-8-13(17-18)11-15(4,5)10-12(3)16/h8-9,12,14H,6-7,10-11H2,1-5H3 |
| InChIKey | IQEPCOWEXQZTON-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|