C17H33N3O — CID 66002071
4-(tert-butylamino)-2-methyl-1-(1-pentan-3-ylpyrazol-3-yl)butan-2-ol (PubChem CID 66002071) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is 4-(tert-butylamino)-2-methyl-1-(1-pentan-3-ylpyrazol-3-yl)butan-2-ol.
| Compound Name | 4-(tert-butylamino)-2-methyl-1-(1-pentan-3-ylpyrazol-3-yl)butan-2-ol |
|---|---|
| PubChem CID | 66002071 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 4-(tert-butylamino)-2-methyl-1-(1-pentan-3-ylpyrazol-3-yl)butan-2-ol |
| SMILES | CCC(CC)n1ccc(CC(C)(O)CCNC(C)(C)C)n1 |
| InChI | InChI=1S/C17H33N3O/c1-7-15(8-2)20-12-9-14(19-20)13-17(6,21)10-11-18-16(3,4)5/h9,12,15,18,21H,7-8,10-11,13H2,1-6H3 |
| InChIKey | CDHDNWHOSAHZNN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |