C14H27N3 — CID 64779874
2-methyl-2-[(1-pentan-3-ylpyrazol-3-yl)methyl]butan-1-amine (PubChem CID 64779874) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 2-methyl-2-[(1-pentan-3-ylpyrazol-3-yl)methyl]butan-1-amine.
| Compound Name | 2-methyl-2-[(1-pentan-3-ylpyrazol-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 64779874 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 2-methyl-2-[(1-pentan-3-ylpyrazol-3-yl)methyl]butan-1-amine |
| SMILES | CCC(CC)n1ccc(CC(C)(CC)CN)n1 |
| InChI | InChI=1S/C14H27N3/c1-5-13(6-2)17-9-8-12(16-17)10-14(4,7-3)11-15/h8-9,13H,5-7,10-11,15H2,1-4H3 |
| InChIKey | MKRMZOKNPATTIF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |