C14H25ClN2 — CID 83151402
1-butan-2-yl-3-[2-(chloromethyl)-2,3-dimethylbutyl]pyrazole (PubChem CID 83151402) has the molecular formula C14H25ClN2 and a molecular weight of 256.82 g/mol. Its IUPAC name is 1-butan-2-yl-3-[2-(chloromethyl)-2,3-dimethylbutyl]pyrazole.
| Compound Name | 1-butan-2-yl-3-[2-(chloromethyl)-2,3-dimethylbutyl]pyrazole |
|---|---|
| PubChem CID | 83151402 |
| Molecular Formula | C14H25ClN2 |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-butan-2-yl-3-[2-(chloromethyl)-2,3-dimethylbutyl]pyrazole |
| SMILES | CCC(C)n1ccc(CC(C)(CCl)C(C)C)n1 |
| InChI | InChI=1S/C14H25ClN2/c1-6-12(4)17-8-7-13(16-17)9-14(5,10-15)11(2)3/h7-8,11-12H,6,9-10H2,1-5H3 |
| InChIKey | DQPBKFISAPYWFY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|