C14H24N2O — CID 64783810
1-(1-butan-2-ylpyrazol-3-yl)-4,4-dimethylpentan-3-one (PubChem CID 64783810) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-3-yl)-4,4-dimethylpentan-3-one.
| Compound Name | 1-(1-butan-2-ylpyrazol-3-yl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 64783810 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-3-yl)-4,4-dimethylpentan-3-one |
| SMILES | CCC(C)n1ccc(CCC(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C14H24N2O/c1-6-11(2)16-10-9-12(15-16)7-8-13(17)14(3,4)5/h9-11H,6-8H2,1-5H3 |
| InChIKey | DNTKAIVLQYNHLS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |