C14H18Cl3F — CID 103042148
4-[2,2-bis(chloromethyl)-4-methylpentyl]-2-chloro-1-fluorobenzene (PubChem CID 103042148) has the molecular formula C14H18Cl3F and a molecular weight of 311.66 g/mol. Its IUPAC name is 4-[2,2-bis(chloromethyl)-4-methylpentyl]-2-chloro-1-fluorobenzene.
| Compound Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]-2-chloro-1-fluorobenzene |
|---|---|
| PubChem CID | 103042148 |
| Molecular Formula | C14H18Cl3F |
| Molecular Weight | 311.66 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]-2-chloro-1-fluorobenzene |
| SMILES | CC(C)CC(CCl)(CCl)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl3F/c1-10(2)6-14(8-15,9-16)7-11-3-4-13(18)12(17)5-11/h3-5,10H,6-9H2,1-2H3 |
| InChIKey | JEFNEIDLVAULCP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|