C12H16ClFO2 — CID 103042129
2-[(3-chloro-4-fluorophenyl)methyl]-2-ethylpropane-1,3-diol (PubChem CID 103042129) has the molecular formula C12H16ClFO2 and a molecular weight of 246.71 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-2-ethylpropane-1,3-diol.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 103042129 |
| Molecular Formula | C12H16ClFO2 |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClFO2/c1-2-12(7-15,8-16)6-9-3-4-11(14)10(13)5-9/h3-5,15-16H,2,6-8H2,1H3 |
| InChIKey | OEUSVSVKZJCQHU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |