C15H21Cl2FO — CID 79447677
4-[2,2-bis(chloromethyl)-4-methylpentyl]-2-fluoro-1-methoxybenzene (PubChem CID 79447677) has the molecular formula C15H21Cl2FO and a molecular weight of 307.24 g/mol. Its IUPAC name is 4-[2,2-bis(chloromethyl)-4-methylpentyl]-2-fluoro-1-methoxybenzene.
| Compound Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]-2-fluoro-1-methoxybenzene |
|---|---|
| PubChem CID | 79447677 |
| Molecular Formula | C15H21Cl2FO |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[2,2-bis(chloromethyl)-4-methylpentyl]-2-fluoro-1-methoxybenzene |
| SMILES | COc1ccc(CC(CCl)(CCl)CC(C)C)cc1F |
| InChI | InChI=1S/C15H21Cl2FO/c1-11(2)7-15(9-16,10-17)8-12-4-5-14(19-3)13(18)6-12/h4-6,11H,7-10H2,1-3H3 |
| InChIKey | NIRMKCOMAVCKGF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|