C13H19F2NO — CID 112566865
2-fluoro-2-[(3-fluoro-4-methoxyphenyl)methyl]-3-methylbutan-1-amine (PubChem CID 112566865) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-fluoro-2-[(3-fluoro-4-methoxyphenyl)methyl]-3-methylbutan-1-amine.
| Compound Name | 2-fluoro-2-[(3-fluoro-4-methoxyphenyl)methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 112566865 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-fluoro-2-[(3-fluoro-4-methoxyphenyl)methyl]-3-methylbutan-1-amine |
| SMILES | COc1ccc(CC(F)(CN)C(C)C)cc1F |
| InChI | InChI=1S/C13H19F2NO/c1-9(2)13(15,8-16)7-10-4-5-12(17-3)11(14)6-10/h4-6,9H,7-8,16H2,1-3H3 |
| InChIKey | MNBZQSJULACDAW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |