C14H22INO — CID 66181180
1-[(4-iodophenyl)methylamino]-2,4-dimethylpentan-2-ol (PubChem CID 66181180) has the molecular formula C14H22INO and a molecular weight of 347.24 g/mol. Its IUPAC name is 1-[(4-iodophenyl)methylamino]-2,4-dimethylpentan-2-ol.
| Compound Name | 1-[(4-iodophenyl)methylamino]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 66181180 |
| Molecular Formula | C14H22INO |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-[(4-iodophenyl)methylamino]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)CC(C)(O)CNCc1ccc(I)cc1 |
| InChI | InChI=1S/C14H22INO/c1-11(2)8-14(3,17)10-16-9-12-4-6-13(15)7-5-12/h4-7,11,16-17H,8-10H2,1-3H3 |
| InChIKey | RHIBSBXRFVTBIP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|