C16H25NO2 — CID 66179768
1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-2,4-dimethylpentan-2-ol (PubChem CID 66179768) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-2,4-dimethylpentan-2-ol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 66179768 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)CC(C)(O)CNCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H25NO2/c1-12(2)9-16(3,18)11-17-10-13-4-5-15-14(8-13)6-7-19-15/h4-5,8,12,17-18H,6-7,9-11H2,1-3H3 |
| InChIKey | OIXUAOMHYMVKFP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|