C11H18IN3O — CID 116648440
1-[(5-iodopyrimidin-2-yl)amino]-2,4-dimethylpentan-2-ol (PubChem CID 116648440) has the molecular formula C11H18IN3O and a molecular weight of 335.19 g/mol. Its IUPAC name is 1-[(5-iodopyrimidin-2-yl)amino]-2,4-dimethylpentan-2-ol.
| Compound Name | 1-[(5-iodopyrimidin-2-yl)amino]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 116648440 |
| Molecular Formula | C11H18IN3O |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[(5-iodopyrimidin-2-yl)amino]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)CC(C)(O)CNc1ncc(I)cn1 |
| InChI | InChI=1S/C11H18IN3O/c1-8(2)4-11(3,16)7-15-10-13-5-9(12)6-14-10/h5-6,8,16H,4,7H2,1-3H3,(H,13,14,15) |
| InChIKey | UAFLMJLEKFVRPY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|