About dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol
dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol (PubChem CID 160602999) has the molecular formula C17H20Cl2O2
and a molecular weight of 327.25 g/mol. Its IUPAC name is dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol.
Molecular Properties
| Compound Name | dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol |
| PubChem CID | 160602999 |
| Molecular Formula | C17H20Cl2O2 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol |
| SMILES | Cc1ccc(C=O)cc1.Cc1ccc(CO)cc1.ClCCl |
| InChI | InChI=1S/C8H10O.C8H8O.CH2Cl2/c2*1-7-2-4-8(6-9)5-3-7;2-1-3/h2-5,9H,6H2,1H3;2-6H,1H3;1H2 |
| InChIKey | RENGOMZJHLWOQW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol?
The IUPAC name of dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol (CID 160602999) is dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol.
What is the SMILES notation for dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol?
The canonical SMILES for dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol is Cc1ccc(C=O)cc1.Cc1ccc(CO)cc1.ClCCl.
What is the InChIKey of dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol?
The InChIKey is RENGOMZJHLWOQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C8H8O.CH2Cl2/c2*1-7-2-4-8(6-9)5-3-7;2-1-3/h2-5,9H,6H2,1H3;2-6H,1H3;1H2.
What are the key properties of dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol?
dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol has a molecular weight of 327.25 g/mol, XLogP of 4.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;4-methylbenzaldehyde;(4-methylphenyl)methanol is sourced from PubChem (CID 160602999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).