About (4-methylphenyl)methanol
(4-methylphenyl)methanol (PubChem CID 138734499) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is (4-methylphenyl)methanol.
Molecular Properties
| Compound Name | (4-methylphenyl)methanol |
| PubChem CID | 138734499 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (4-methylphenyl)methanol |
| SMILES | Cc1ccc(CO)cc1.Cc1ccc(CO)cc1 |
| InChI | InChI=1S/2C8H10O/c2*1-7-2-4-8(6-9)5-3-7/h2*2-5,9H,6H2,1H3 |
| InChIKey | JJXITCODJIQJDA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methanol?
The IUPAC name of (4-methylphenyl)methanol (CID 138734499) is (4-methylphenyl)methanol.
What is the SMILES notation for (4-methylphenyl)methanol?
The canonical SMILES for (4-methylphenyl)methanol is Cc1ccc(CO)cc1.Cc1ccc(CO)cc1.
What is the InChIKey of (4-methylphenyl)methanol?
The InChIKey is JJXITCODJIQJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10O/c2*1-7-2-4-8(6-9)5-3-7/h2*2-5,9H,6H2,1H3.
What are the key properties of (4-methylphenyl)methanol?
(4-methylphenyl)methanol has a molecular weight of 244.33 g/mol, XLogP of 2.97, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methanol is sourced from PubChem (CID 138734499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).