C24H26O6 — CID 158398073
1-[4-(hydroxymethyl)phenyl]pentane-1,4-dione;4-(4-oxopentanoyl)benzaldehyde (PubChem CID 158398073) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)phenyl]pentane-1,4-dione;4-(4-oxopentanoyl)benzaldehyde.
| Compound Name | 1-[4-(hydroxymethyl)phenyl]pentane-1,4-dione;4-(4-oxopentanoyl)benzaldehyde |
|---|---|
| PubChem CID | 158398073 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 1-[4-(hydroxymethyl)phenyl]pentane-1,4-dione;4-(4-oxopentanoyl)benzaldehyde |
| SMILES | CC(=O)CCC(=O)c1ccc(C=O)cc1.CC(=O)CCC(=O)c1ccc(CO)cc1 |
| InChI | InChI=1S/C12H14O3.C12H12O3/c2*1-9(14)2-7-12(15)11-5-3-10(8-13)4-6-11/h3-6,13H,2,7-8H2,1H3;3-6,8H,2,7H2,1H3 |
| InChIKey | GXTJXNXGEVIYMU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|