About CID 162414394
CID 162414394 (PubChem CID 162414394) has the molecular formula C12H16BNO2
and a molecular weight of 217.08 g/mol.
Molecular Properties
| Compound Name | CID 162414394 |
| PubChem CID | 162414394 |
| Molecular Formula | C12H16BNO2 |
| Molecular Weight | 217.08 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | — |
| SMILES | CN(C)C.[B]CC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C9H7BO2.C3H9N/c10-5-9(12)8-3-1-7(6-11)2-4-8;1-4(2)3/h1-4,6H,5H2;1-3H3 |
| InChIKey | VBLSTAONBSFMTL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.08 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162414394 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162414394?
The IUPAC name of CID 162414394 (CID 162414394) is not available.
What is the SMILES notation for CID 162414394?
The canonical SMILES for CID 162414394 is CN(C)C.[B]CC(=O)c1ccc(C=O)cc1.
What is the InChIKey of CID 162414394?
The InChIKey is VBLSTAONBSFMTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BO2.C3H9N/c10-5-9(12)8-3-1-7(6-11)2-4-8;1-4(2)3/h1-4,6H,5H2;1-3H3.
What are the key properties of CID 162414394?
CID 162414394 has a molecular weight of 217.08 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162414394 is sourced from PubChem (CID 162414394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).