About sodium;hydride;4-methylbenzaldehyde
sodium;hydride;4-methylbenzaldehyde (PubChem CID 173013137) has the molecular formula C8H9NaO
and a molecular weight of 144.15 g/mol. Its IUPAC name is sodium;hydride;4-methylbenzaldehyde.
Molecular Properties
| Compound Name | sodium;hydride;4-methylbenzaldehyde |
| PubChem CID | 173013137 |
| Molecular Formula | C8H9NaO |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | sodium;hydride;4-methylbenzaldehyde |
| SMILES | Cc1ccc(C=O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C8H8O.Na.H/c1-7-2-4-8(6-9)5-3-7;;/h2-6H,1H3;;/q;+1;-1 |
| InChIKey | UDAJDTQGBZRQTA-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-methylbenzaldehyde?
The IUPAC name of sodium;hydride;4-methylbenzaldehyde (CID 173013137) is sodium;hydride;4-methylbenzaldehyde.
What is the SMILES notation for sodium;hydride;4-methylbenzaldehyde?
The canonical SMILES for sodium;hydride;4-methylbenzaldehyde is Cc1ccc(C=O)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-methylbenzaldehyde?
The InChIKey is UDAJDTQGBZRQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.Na.H/c1-7-2-4-8(6-9)5-3-7;;/h2-6H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;4-methylbenzaldehyde?
sodium;hydride;4-methylbenzaldehyde has a molecular weight of 144.15 g/mol, XLogP of -1.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-methylbenzaldehyde is sourced from PubChem (CID 173013137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).