About benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde
benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde (PubChem CID 158703985) has the molecular formula C22H19ClO3
and a molecular weight of 366.84 g/mol. Its IUPAC name is benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde.
Molecular Properties
| Compound Name | benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde |
| PubChem CID | 158703985 |
| Molecular Formula | C22H19ClO3 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde |
| SMILES | Cc1ccc(C=O)cc1.O=Cc1ccc(Cl)cc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C8H8O.C7H5ClO.C7H6O/c1-7-2-4-8(6-9)5-3-7;8-7-3-1-6(5-9)2-4-7;8-6-7-4-2-1-3-5-7/h2-6H,1H3;1-5H;1-6H |
| InChIKey | IHWRVSQRMQYKBA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde?
The IUPAC name of benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde (CID 158703985) is benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde.
What is the SMILES notation for benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde?
The canonical SMILES for benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde is Cc1ccc(C=O)cc1.O=Cc1ccc(Cl)cc1.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde?
The InChIKey is IHWRVSQRMQYKBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C7H5ClO.C7H6O/c1-7-2-4-8(6-9)5-3-7;8-7-3-1-6(5-9)2-4-7;8-6-7-4-2-1-3-5-7/h2-6H,1H3;1-5H;1-6H.
What are the key properties of benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde?
benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde has a molecular weight of 366.84 g/mol, XLogP of 5.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;4-chlorobenzaldehyde;4-methylbenzaldehyde is sourced from PubChem (CID 158703985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).