C16H19O2P — CID 174455120
benzaldehyde;oxophosphane;1,3,5-trimethylbenzene (PubChem CID 174455120) has the molecular formula C16H19O2P and a molecular weight of 274.30 g/mol. Its IUPAC name is benzaldehyde;oxophosphane;1,3,5-trimethylbenzene.
| Compound Name | benzaldehyde;oxophosphane;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 174455120 |
| Molecular Formula | C16H19O2P |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | benzaldehyde;oxophosphane;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.O=Cc1ccccc1.O=P |
| InChI | InChI=1S/C9H12.C7H6O.HOP/c1-7-4-8(2)6-9(3)5-7;8-6-7-4-2-1-3-5-7;1-2/h4-6H,1-3H3;1-6H;2H |
| InChIKey | YXHKTPUFONZVAD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|