About benzaldehyde;naphthalene;hydroiodide
benzaldehyde;naphthalene;hydroiodide (PubChem CID 174808118) has the molecular formula C17H15IO
and a molecular weight of 362.21 g/mol. Its IUPAC name is benzaldehyde;naphthalene;hydroiodide.
Molecular Properties
| Compound Name | benzaldehyde;naphthalene;hydroiodide |
| PubChem CID | 174808118 |
| Molecular Formula | C17H15IO |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | benzaldehyde;naphthalene;hydroiodide |
| SMILES | I.O=Cc1ccccc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C7H6O.HI/c1-2-6-10-8-4-3-7-9(10)5-1;8-6-7-4-2-1-3-5-7;/h1-8H;1-6H;1H |
| InChIKey | JUIWXVAWQPOYFX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;naphthalene;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;naphthalene;hydroiodide?
The IUPAC name of benzaldehyde;naphthalene;hydroiodide (CID 174808118) is benzaldehyde;naphthalene;hydroiodide.
What is the SMILES notation for benzaldehyde;naphthalene;hydroiodide?
The canonical SMILES for benzaldehyde;naphthalene;hydroiodide is I.O=Cc1ccccc1.c1ccc2ccccc2c1.
What is the InChIKey of benzaldehyde;naphthalene;hydroiodide?
The InChIKey is JUIWXVAWQPOYFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C7H6O.HI/c1-2-6-10-8-4-3-7-9(10)5-1;8-6-7-4-2-1-3-5-7;/h1-8H;1-6H;1H.
What are the key properties of benzaldehyde;naphthalene;hydroiodide?
benzaldehyde;naphthalene;hydroiodide has a molecular weight of 362.21 g/mol, XLogP of 4.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;naphthalene;hydroiodide is sourced from PubChem (CID 174808118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).