About 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene
4-chlorobenzaldehyde;1-methoxy-2-methylbenzene (PubChem CID 144659378) has the molecular formula C15H15ClO2
and a molecular weight of 262.74 g/mol. Its IUPAC name is 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene.
Molecular Properties
| Compound Name | 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene |
| PubChem CID | 144659378 |
| Molecular Formula | C15H15ClO2 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene |
| SMILES | COc1ccccc1C.O=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H10O.C7H5ClO/c1-7-5-3-4-6-8(7)9-2;8-7-3-1-6(5-9)2-4-7/h3-6H,1-2H3;1-5H |
| InChIKey | PRNALBDVBPSDGB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene?
The IUPAC name of 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene (CID 144659378) is 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene.
What is the SMILES notation for 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene?
The canonical SMILES for 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene is COc1ccccc1C.O=Cc1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene?
The InChIKey is PRNALBDVBPSDGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C7H5ClO/c1-7-5-3-4-6-8(7)9-2;8-7-3-1-6(5-9)2-4-7/h3-6H,1-2H3;1-5H.
What are the key properties of 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene?
4-chlorobenzaldehyde;1-methoxy-2-methylbenzene has a molecular weight of 262.74 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzaldehyde;1-methoxy-2-methylbenzene is sourced from PubChem (CID 144659378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).