C16H18O5 — CID 175414068
1,2-dimethoxybenzene;4-hydroxy-3-methoxybenzaldehyde (PubChem CID 175414068) has the molecular formula C16H18O5 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;4-hydroxy-3-methoxybenzaldehyde.
| Compound Name | 1,2-dimethoxybenzene;4-hydroxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 175414068 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1,2-dimethoxybenzene;4-hydroxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1O.COc1ccccc1OC |
| InChI | InChI=1S/C8H8O3.C8H10O2/c1-11-8-4-6(5-9)2-3-7(8)10;1-9-7-5-3-4-6-8(7)10-2/h2-5,10H,1H3;3-6H,1-2H3 |
| InChIKey | KOBLBZMJLUKTHG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|