About 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid
4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid (PubChem CID 53442983) has the molecular formula C12H16O5
and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid.
Molecular Properties
| Compound Name | 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid |
| PubChem CID | 53442983 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid |
| SMILES | CC(C)C(=O)O.COc1cc(C=O)ccc1O |
| InChI | InChI=1S/C8H8O3.C4H8O2/c1-11-8-4-6(5-9)2-3-7(8)10;1-3(2)4(5)6/h2-5,10H,1H3;3H,1-2H3,(H,5,6) |
| InChIKey | GZBFNDILWKVRDT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid?
The IUPAC name of 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid (CID 53442983) is 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid.
What is the SMILES notation for 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid?
The canonical SMILES for 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid is CC(C)C(=O)O.COc1cc(C=O)ccc1O.
What is the InChIKey of 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid?
The InChIKey is GZBFNDILWKVRDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C4H8O2/c1-11-8-4-6(5-9)2-3-7(8)10;1-3(2)4(5)6/h2-5,10H,1H3;3H,1-2H3,(H,5,6).
What are the key properties of 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid?
4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid has a molecular weight of 240.25 g/mol, XLogP of 1.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-methoxybenzaldehyde;2-methylpropanoic acid is sourced from PubChem (CID 53442983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).