About furan;4-hydroxy-3-methoxybenzaldehyde
furan;4-hydroxy-3-methoxybenzaldehyde (PubChem CID 174443799) has the molecular formula C12H12O4
and a molecular weight of 220.22 g/mol. Its IUPAC name is furan;4-hydroxy-3-methoxybenzaldehyde.
Molecular Properties
| Compound Name | furan;4-hydroxy-3-methoxybenzaldehyde |
| PubChem CID | 174443799 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | furan;4-hydroxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1O.c1ccoc1 |
| InChI | InChI=1S/C8H8O3.C4H4O/c1-11-8-4-6(5-9)2-3-7(8)10;1-2-4-5-3-1/h2-5,10H,1H3;1-4H |
| InChIKey | QLMCTWYTSUJUGU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze furan;4-hydroxy-3-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan;4-hydroxy-3-methoxybenzaldehyde?
The IUPAC name of furan;4-hydroxy-3-methoxybenzaldehyde (CID 174443799) is furan;4-hydroxy-3-methoxybenzaldehyde.
What is the SMILES notation for furan;4-hydroxy-3-methoxybenzaldehyde?
The canonical SMILES for furan;4-hydroxy-3-methoxybenzaldehyde is COc1cc(C=O)ccc1O.c1ccoc1.
What is the InChIKey of furan;4-hydroxy-3-methoxybenzaldehyde?
The InChIKey is QLMCTWYTSUJUGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C4H4O/c1-11-8-4-6(5-9)2-3-7(8)10;1-2-4-5-3-1/h2-5,10H,1H3;1-4H.
What are the key properties of furan;4-hydroxy-3-methoxybenzaldehyde?
furan;4-hydroxy-3-methoxybenzaldehyde has a molecular weight of 220.22 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan;4-hydroxy-3-methoxybenzaldehyde is sourced from PubChem (CID 174443799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).