About 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane
4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane (PubChem CID 175505824) has the molecular formula C26H23O6PS
and a molecular weight of 494.51 g/mol. Its IUPAC name is 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane.
Molecular Properties
| Compound Name | 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane |
| PubChem CID | 175505824 |
| Molecular Formula | C26H23O6PS |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane |
| SMILES | COc1cc(C=O)ccc1O.S=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H15O3PS.C8H8O3/c23-22(19-16-10-4-1-5-11-16,20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;1-11-8-4-6(5-9)2-3-7(8)10/h1-15H;2-5,10H,1H3 |
| InChIKey | YSFDINFLDWGBHU-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane?
The IUPAC name of 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane (CID 175505824) is 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane.
What is the SMILES notation for 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane?
The canonical SMILES for 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane is COc1cc(C=O)ccc1O.S=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane?
The InChIKey is YSFDINFLDWGBHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15O3PS.C8H8O3/c23-22(19-16-10-4-1-5-11-16,20-17-12-6-2-7-13-17)21-18-14-8-3-9-15-18;1-11-8-4-6(5-9)2-3-7(8)10/h1-15H;2-5,10H,1H3.
What are the key properties of 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane?
4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane has a molecular weight of 494.51 g/mol, XLogP of 6.66, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-methoxybenzaldehyde;triphenoxy(sulfanylidene)-λ5-phosphane is sourced from PubChem (CID 175505824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).