C16H19O6P — CID 175485767
2-methoxy-4-prop-1-enylphenol;phenyl dihydrogen phosphate (PubChem CID 175485767) has the molecular formula C16H19O6P and a molecular weight of 338.30 g/mol. Its IUPAC name is 2-methoxy-4-prop-1-enylphenol;phenyl dihydrogen phosphate.
| Compound Name | 2-methoxy-4-prop-1-enylphenol;phenyl dihydrogen phosphate |
|---|---|
| PubChem CID | 175485767 |
| Molecular Formula | C16H19O6P |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-methoxy-4-prop-1-enylphenol;phenyl dihydrogen phosphate |
| SMILES | CC=Cc1ccc(O)c(OC)c1.O=P(O)(O)Oc1ccccc1 |
| InChI | InChI=1S/C10H12O2.C6H7O4P/c1-3-4-8-5-6-9(11)10(7-8)12-2;7-11(8,9)10-6-4-2-1-3-5-6/h3-7,11H,1-2H3;1-5H,(H2,7,8,9) |
| InChIKey | AKOCJONRIJGCKF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|