C16H17O5P — CID 175485766
[2-methoxy-4-[(E)-prop-1-enyl]phenyl] phenyl hydrogen phosphate (PubChem CID 175485766) has the molecular formula C16H17O5P and a molecular weight of 320.28 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-prop-1-enyl]phenyl] phenyl hydrogen phosphate.
| Compound Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 175485766 |
| Molecular Formula | C16H17O5P |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] phenyl hydrogen phosphate |
| SMILES | C/C=C/c1ccc(OP(=O)(O)Oc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C16H17O5P/c1-3-7-13-10-11-15(16(12-13)19-2)21-22(17,18)20-14-8-5-4-6-9-14/h3-12H,1-2H3,(H,17,18)/b7-3+ |
| InChIKey | VJHCZHDXLUOCER-XVNBXDOJSA-N |
| XLogP | 4.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|