C22H25NO5 — CID 120700681
3-[[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]amino]-2-methyl-2-phenylpropanoic acid (PubChem CID 120700681) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 3-[[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]amino]-2-methyl-2-phenylpropanoic acid.
| Compound Name | 3-[[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]amino]-2-methyl-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 120700681 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 3-[[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetyl]amino]-2-methyl-2-phenylpropanoic acid |
| SMILES | C/C=C/c1ccc(OCC(=O)NCC(C)(C(=O)O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H25NO5/c1-4-8-16-11-12-18(19(13-16)27-3)28-14-20(24)23-15-22(2,21(25)26)17-9-6-5-7-10-17/h4-13H,14-15H2,1-3H3,(H,23,24)(H,25,26)/b8-4+ |
| InChIKey | WAUKXDVUVJKWQR-XBXARRHUSA-N |
| XLogP | 3.27 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |