C18H21ClO3 — CID 155412642
4-chloro-3,5-dimethylphenol;2-methoxy-4-[(E)-prop-1-enyl]phenol (PubChem CID 155412642) has the molecular formula C18H21ClO3 and a molecular weight of 320.82 g/mol. Its IUPAC name is 4-chloro-3,5-dimethylphenol;2-methoxy-4-[(E)-prop-1-enyl]phenol.
| Compound Name | 4-chloro-3,5-dimethylphenol;2-methoxy-4-[(E)-prop-1-enyl]phenol |
|---|---|
| PubChem CID | 155412642 |
| Molecular Formula | C18H21ClO3 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-chloro-3,5-dimethylphenol;2-methoxy-4-[(E)-prop-1-enyl]phenol |
| SMILES | C/C=C/c1ccc(O)c(OC)c1.Cc1cc(O)cc(C)c1Cl |
| InChI | InChI=1S/C10H12O2.C8H9ClO/c1-3-4-8-5-6-9(11)10(7-8)12-2;1-5-3-7(10)4-6(2)8(5)9/h3-7,11H,1-2H3;3-4,10H,1-2H3/b4-3+; |
| InChIKey | XLTYYVVQHGFBHB-BJILWQEISA-N |
| XLogP | 5.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |