C17H18O6 — CID 174683420
3,4-dimethoxybenzaldehyde;4-hydroxy-3-methoxybenzaldehyde (PubChem CID 174683420) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is 3,4-dimethoxybenzaldehyde;4-hydroxy-3-methoxybenzaldehyde.
| Compound Name | 3,4-dimethoxybenzaldehyde;4-hydroxy-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 174683420 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3,4-dimethoxybenzaldehyde;4-hydroxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1O.COc1ccc(C=O)cc1OC |
| InChI | InChI=1S/C9H10O3.C8H8O3/c1-11-8-4-3-7(6-10)5-9(8)12-2;1-11-8-4-6(5-9)2-3-7(8)10/h3-6H,1-2H3;2-5,10H,1H3 |
| InChIKey | VLZZSCOOBGCJDL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|