C19H19ClO2 — CID 154715578
(E,2S)-5-(4-chlorophenyl)-2-(2-methoxyphenyl)-2-methylpent-4-enal (PubChem CID 154715578) has the molecular formula C19H19ClO2 and a molecular weight of 314.81 g/mol. Its IUPAC name is (E,2S)-5-(4-chlorophenyl)-2-(2-methoxyphenyl)-2-methylpent-4-enal.
| Compound Name | (E,2S)-5-(4-chlorophenyl)-2-(2-methoxyphenyl)-2-methylpent-4-enal |
|---|---|
| PubChem CID | 154715578 |
| Molecular Formula | C19H19ClO2 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (E,2S)-5-(4-chlorophenyl)-2-(2-methoxyphenyl)-2-methylpent-4-enal |
| SMILES | COc1ccccc1[C@@](C)(C=O)C/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClO2/c1-19(14-21,17-7-3-4-8-18(17)22-2)13-5-6-15-9-11-16(20)12-10-15/h3-12,14H,13H2,1-2H3/b6-5+/t19-/m1/s1 |
| InChIKey | GKYKYJWTLCLSBB-ZMBJWTFHSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|