C18H16Cl2 — CID 141391243
1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene (PubChem CID 141391243) has the molecular formula C18H16Cl2 and a molecular weight of 303.23 g/mol. Its IUPAC name is 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene.
| Compound Name | 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene |
|---|---|
| PubChem CID | 141391243 |
| Molecular Formula | C18H16Cl2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene |
| SMILES | Clc1ccc(C=CCCC=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H16Cl2/c19-17-11-7-15(8-12-17)5-3-1-2-4-6-16-9-13-18(20)14-10-16/h3-14H,1-2H2 |
| InChIKey | UQSXRKMNXOAUKK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|