About 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene
1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene (PubChem CID 141391243) has the molecular formula C18H16Cl2
and a molecular weight of 303.23 g/mol. Its IUPAC name is 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene.
Molecular Properties
| Compound Name | 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene |
| PubChem CID | 141391243 |
| Molecular Formula | C18H16Cl2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene |
| SMILES | Clc1ccc(C=CCCC=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H16Cl2/c19-17-11-7-15(8-12-17)5-3-1-2-4-6-16-9-13-18(20)14-10-16/h3-14H,1-2H2 |
| InChIKey | UQSXRKMNXOAUKK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene?
The IUPAC name of 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene (CID 141391243) is 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene.
What is the SMILES notation for 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene?
The canonical SMILES for 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene is Clc1ccc(C=CCCC=Cc2ccc(Cl)cc2)cc1.
What is the InChIKey of 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene?
The InChIKey is UQSXRKMNXOAUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2/c19-17-11-7-15(8-12-17)5-3-1-2-4-6-16-9-13-18(20)14-10-16/h3-14H,1-2H2.
What are the key properties of 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene?
1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene has a molecular weight of 303.23 g/mol, XLogP of 6.50, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[6-(4-chlorophenyl)hexa-1,5-dienyl]benzene is sourced from PubChem (CID 141391243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).