C18H18ClNO2 — CID 26268813
(E)-3-(4-chlorophenyl)-N-[(2-methoxyphenyl)methyl]-N-methylprop-2-enamide (PubChem CID 26268813) has the molecular formula C18H18ClNO2 and a molecular weight of 315.80 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[(2-methoxyphenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[(2-methoxyphenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26268813 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[(2-methoxyphenyl)methyl]-N-methylprop-2-enamide |
| SMILES | COc1ccccc1CN(C)C(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO2/c1-20(13-15-5-3-4-6-17(15)22-2)18(21)12-9-14-7-10-16(19)11-8-14/h3-12H,13H2,1-2H3/b12-9+ |
| InChIKey | MHCSHYSCBPFKAG-FMIVXFBMSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|