C19H19Cl2NO3 — CID 9417727
(E)-N-[(2,4-dichlorophenyl)methyl]-3-(3,4-dimethoxyphenyl)-N-methylprop-2-enamide (PubChem CID 9417727) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is (E)-N-[(2,4-dichlorophenyl)methyl]-3-(3,4-dimethoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[(2,4-dichlorophenyl)methyl]-3-(3,4-dimethoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9417727 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (E)-N-[(2,4-dichlorophenyl)methyl]-3-(3,4-dimethoxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(C)Cc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C19H19Cl2NO3/c1-22(12-14-6-7-15(20)11-16(14)21)19(23)9-5-13-4-8-17(24-2)18(10-13)25-3/h4-11H,12H2,1-3H3/b9-5+ |
| InChIKey | ZLBHVMOYQUMPRQ-WEVVVXLNSA-N |
| XLogP | 4.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|