About bis(4-chlorophenol);chromium
bis(4-chlorophenol);chromium (PubChem CID 152534645) has the molecular formula C12H10Cl2CrO2
and a molecular weight of 309.11 g/mol. Its IUPAC name is bis(4-chlorophenol);chromium.
Molecular Properties
| Compound Name | bis(4-chlorophenol);chromium |
| PubChem CID | 152534645 |
| Molecular Formula | C12H10Cl2CrO2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | bis(4-chlorophenol);chromium |
| SMILES | Oc1ccc(Cl)cc1.Oc1ccc(Cl)cc1.[Cr] |
| InChI | InChI=1S/2C6H5ClO.Cr/c2*7-5-1-3-6(8)4-2-5;/h2*1-4,8H; |
| InChIKey | JVKOZXAIZVIFEM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(4-chlorophenol);chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chlorophenol);chromium?
The IUPAC name of bis(4-chlorophenol);chromium (CID 152534645) is bis(4-chlorophenol);chromium.
What is the SMILES notation for bis(4-chlorophenol);chromium?
The canonical SMILES for bis(4-chlorophenol);chromium is Oc1ccc(Cl)cc1.Oc1ccc(Cl)cc1.[Cr].
What is the InChIKey of bis(4-chlorophenol);chromium?
The InChIKey is JVKOZXAIZVIFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5ClO.Cr/c2*7-5-1-3-6(8)4-2-5;/h2*1-4,8H;.
What are the key properties of bis(4-chlorophenol);chromium?
bis(4-chlorophenol);chromium has a molecular weight of 309.11 g/mol, XLogP of 4.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chlorophenol);chromium is sourced from PubChem (CID 152534645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).