C11H11Cl — CID 58174508
1-chloro-4-[(3Z)-penta-1,3-dien-3-yl]benzene (PubChem CID 58174508) has the molecular formula C11H11Cl and a molecular weight of 178.66 g/mol. Its IUPAC name is 1-chloro-4-[(3Z)-penta-1,3-dien-3-yl]benzene.
| Compound Name | 1-chloro-4-[(3Z)-penta-1,3-dien-3-yl]benzene |
|---|---|
| PubChem CID | 58174508 |
| Molecular Formula | C11H11Cl |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 1-chloro-4-[(3Z)-penta-1,3-dien-3-yl]benzene |
| SMILES | C=C/C(=C/C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11Cl/c1-3-9(4-2)10-5-7-11(12)8-6-10/h3-8H,1H2,2H3/b9-4- |
| InChIKey | XVZBDJJLKNNVSP-WTKPLQERSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|