C11H10Cl2 — CID 125476058
1-chloro-4-[(1E)-1-chloropenta-1,4-dienyl]benzene (PubChem CID 125476058) has the molecular formula C11H10Cl2 and a molecular weight of 213.11 g/mol. Its IUPAC name is 1-chloro-4-[(1E)-1-chloropenta-1,4-dienyl]benzene.
| Compound Name | 1-chloro-4-[(1E)-1-chloropenta-1,4-dienyl]benzene |
|---|---|
| PubChem CID | 125476058 |
| Molecular Formula | C11H10Cl2 |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 1-chloro-4-[(1E)-1-chloropenta-1,4-dienyl]benzene |
| SMILES | C=CC/C=C(/Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10Cl2/c1-2-3-4-11(13)9-5-7-10(12)8-6-9/h2,4-8H,1,3H2/b11-4+ |
| InChIKey | LLTPRVNULAMILI-NYYWCZLTSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|