C56H32Cl8 — CID 101072284
1-chloro-4-[(4-chlorophenyl)-[2,3,4-tris[bis(4-chlorophenyl)methylidene]cyclobutylidene]methyl]benzene (PubChem CID 101072284) has the molecular formula C56H32Cl8 and a molecular weight of 988.50 g/mol. Its IUPAC name is 1-chloro-4-[(4-chlorophenyl)-[2,3,4-tris[bis(4-chlorophenyl)methylidene]cyclobutylidene]methyl]benzene.
| Compound Name | 1-chloro-4-[(4-chlorophenyl)-[2,3,4-tris[bis(4-chlorophenyl)methylidene]cyclobutylidene]methyl]benzene |
|---|---|
| PubChem CID | 101072284 |
| Molecular Formula | C56H32Cl8 |
| Molecular Weight | 988.50 g/mol |
| Exact Mass | 984.00 |
| IUPAC Name | 1-chloro-4-[(4-chlorophenyl)-[2,3,4-tris[bis(4-chlorophenyl)methylidene]cyclobutylidene]methyl]benzene |
| SMILES | Clc1ccc(C(=C2C(=C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)C(=C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)C2=C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C56H32Cl8/c57-41-17-1-33(2-18-41)49(34-3-19-42(58)20-4-34)53-54(50(35-5-21-43(59)22-6-35)36-7-23-44(60)24-8-36)56(52(39-13-29-47(63)30-14-39)40-15-31-48(64)32-16-40)55(53)51(37-9-25-45(61)26-10-37)38-11-27-46(62)28-12-38/h1-32H |
| InChIKey | JEZXHRHVYZVPLT-UHFFFAOYSA-N |
| XLogP | 19.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.50 |
| LogP ≤ 5 | 19.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |