C14H10Cl2S2 — CID 101018252
(E)-1,2-bis(4-chlorophenyl)ethene-1,2-dithiol (PubChem CID 101018252) has the molecular formula C14H10Cl2S2 and a molecular weight of 313.27 g/mol. Its IUPAC name is (E)-1,2-bis(4-chlorophenyl)ethene-1,2-dithiol.
| Compound Name | (E)-1,2-bis(4-chlorophenyl)ethene-1,2-dithiol |
|---|---|
| PubChem CID | 101018252 |
| Molecular Formula | C14H10Cl2S2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | (E)-1,2-bis(4-chlorophenyl)ethene-1,2-dithiol |
| SMILES | S/C(=C(/S)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2S2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8,17-18H/b14-13+ |
| InChIKey | JLVKESKWIDBDTO-BUHFOSPRSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|