C9H10ClN3O2S2 — CID 174055082
[amino-(4-chlorophenyl)methylidene]carbamothioic S-acid;carbamothioic S-acid (PubChem CID 174055082) has the molecular formula C9H10ClN3O2S2 and a molecular weight of 291.79 g/mol. Its IUPAC name is [amino-(4-chlorophenyl)methylidene]carbamothioic S-acid;carbamothioic S-acid.
| Compound Name | [amino-(4-chlorophenyl)methylidene]carbamothioic S-acid;carbamothioic S-acid |
|---|---|
| PubChem CID | 174055082 |
| Molecular Formula | C9H10ClN3O2S2 |
| Molecular Weight | 291.79 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | [amino-(4-chlorophenyl)methylidene]carbamothioic S-acid;carbamothioic S-acid |
| SMILES | NC(=NC(=O)S)c1ccc(Cl)cc1.NC(=O)S |
| InChI | InChI=1S/C8H7ClN2OS.CH3NOS/c9-6-3-1-5(2-4-6)7(10)11-8(12)13;2-1(3)4/h1-4H,(H3,10,11,12,13);(H3,2,3,4) |
| InChIKey | NFIWEIJFNNQUKP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.79 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|